* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34353397 |
| English Synonyms: | UKRORGSYN-BB BBV-34353397 |
| MDL Number.: | MFCD16804366 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc(sc1)CNCCSc2ncccn2 |
| InChi: | InChI=1S/C11H13N3S2/c1-3-10(15-7-1)9-12-6-8-16-11-13-4-2-5-14-11/h1-5,7,12H,6,8-9H2 |
| InChiKey: | InChIKey=ALVOIQRWFQKSGK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.