* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34353873 |
| English Synonyms: | UKRORGSYN-BB BBV-34353873 |
| MDL Number.: | MFCD16804842 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCCCSC(C)CNCc1cccs1 |
| InChi: | InChI=1S/C12H21NS2/c1-3-4-7-14-11(2)9-13-10-12-6-5-8-15-12/h5-6,8,11,13H,3-4,7,9-10H2,1-2H3 |
| InChiKey: | InChIKey=CFASBJGLTVXBBJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.