* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34353969 |
| English Synonyms: | UKRORGSYN-BB BBV-34353969 |
| MDL Number.: | MFCD16804938 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1nnc(s1)SC(C)CNC(C)(C)C |
| InChi: | InChI=1S/C10H19N3S2/c1-7(6-11-10(3,4)5)14-9-13-12-8(2)15-9/h7,11H,6H2,1-5H3 |
| InChiKey: | InChIKey=ILAKSOAWDHEUNP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.