* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34353997 |
| English Synonyms: | UKRORGSYN-BB BBV-34353997 |
| MDL Number.: | MFCD16804966 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1nnc(s1)SCCNCCCC(C)C |
| InChi: | InChI=1S/C11H21N3S2/c1-9(2)5-4-6-12-7-8-15-11-14-13-10(3)16-11/h9,12H,4-8H2,1-3H3 |
| InChiKey: | InChIKey=GUMGEMHKBONEPP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.