* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354005 |
English Synonyms: | UKRORGSYN-BB BBV-34354005 |
MDL Number.: | MFCD16804974 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1nnc(s1)SC(C)CNC |
InChi: | InChI=1S/C7H13N3S2/c1-5(4-8-3)11-7-10-9-6(2)12-7/h5,8H,4H2,1-3H3 |
InChiKey: | InChIKey=ULRVCGBAIZDSQS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.