* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354006 |
English Synonyms: | UKRORGSYN-BB BBV-34354006 |
MDL Number.: | MFCD16804975 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCNCC(C)Sc1nnc(s1)C |
InChi: | InChI=1S/C8H15N3S2/c1-4-9-5-6(2)12-8-11-10-7(3)13-8/h6,9H,4-5H2,1-3H3 |
InChiKey: | InChIKey=HAHHCWSTRBWDJG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.