* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34354017 |
| English Synonyms: | UKRORGSYN-BB BBV-34354017 |
| MDL Number.: | MFCD16804986 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1nnc(s1)SCCNCC2CC2 |
| InChi: | InChI=1S/C9H15N3S2/c1-7-11-12-9(14-7)13-5-4-10-6-8-2-3-8/h8,10H,2-6H2,1H3 |
| InChiKey: | InChIKey=BBMRUWAVHGSHIW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.