* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354290 |
English Synonyms: | UKRORGSYN-BB BBV-34354290 |
MDL Number.: | MFCD16805258 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1nnc(o1)SC(C)CNCC(C)C |
InChi: | InChI=1S/C10H19N3OS/c1-7(2)5-11-6-8(3)15-10-13-12-9(4)14-10/h7-8,11H,5-6H2,1-4H3 |
InChiKey: | InChIKey=AATHUWKLDIPYTP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.