* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34354373 |
| English Synonyms: | UKRORGSYN-BB BBV-34354373 |
| MDL Number.: | MFCD16805341 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1cc(n(n1)C)SC(C)CNCC#C |
| InChi: | InChI=1S/C11H17N3S/c1-5-6-12-8-10(3)15-11-7-9(2)13-14(11)4/h1,7,10,12H,6,8H2,2-4H3 |
| InChiKey: | InChIKey=PBTVFXYPBYSJKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.