* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34354383 |
| English Synonyms: | UKRORGSYN-BB BBV-34354383 |
| MDL Number.: | MFCD16805351 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1cc(n(n1)C)SC(C)CNC2CC2 |
| InChi: | InChI=1S/C11H19N3S/c1-8-6-11(14(3)13-8)15-9(2)7-12-10-4-5-10/h6,9-10,12H,4-5,7H2,1-3H3 |
| InChiKey: | InChIKey=YQLRJKSZPNKAMA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.