* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354445 |
English Synonyms: | UKRORGSYN-BB BBV-34354445 |
MDL Number.: | MFCD16805411 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(CNCc1ccco1)SC |
InChi: | InChI=1S/C9H15NOS/c1-8(12-2)6-10-7-9-4-3-5-11-9/h3-5,8,10H,6-7H2,1-2H3 |
InChiKey: | InChIKey=ZHSDNFMFAMVPIU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.