* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354520 |
English Synonyms: | UKRORGSYN-BB BBV-34354520 |
MDL Number.: | MFCD16805485 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(sc1CNCCSc2nccs2)Cl |
InChi: | InChI=1S/C10H11ClN2S3/c11-9-2-1-8(16-9)7-12-3-5-14-10-13-4-6-15-10/h1-2,4,6,12H,3,5,7H2 |
InChiKey: | InChIKey=UKULXWDDKIJLMQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.