* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354533 |
English Synonyms: | UKRORGSYN-BB BBV-34354533 |
MDL Number.: | MFCD16805498 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(CNCC1CCCO1)Sc2nccs2 |
InChi: | InChI=1S/C11H18N2OS2/c1-9(16-11-13-4-6-15-11)7-12-8-10-3-2-5-14-10/h4,6,9-10,12H,2-3,5,7-8H2,1H3 |
InChiKey: | InChIKey=CWOBVOFLCAUFCA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.