* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354547 |
English Synonyms: | UKRORGSYN-BB BBV-34354547 |
MDL Number.: | MFCD16805512 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(sc1)CCNCCSc2nccs2 |
InChi: | InChI=1S/C11H14N2S3/c1-2-10(14-7-1)3-4-12-5-8-15-11-13-6-9-16-11/h1-2,6-7,9,12H,3-5,8H2 |
InChiKey: | InChIKey=ARSFAYSBHRPQGY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.