* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34354634 |
| English Synonyms: | UKRORGSYN-BB BBV-34354634 |
| MDL Number.: | MFCD16805599 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1[nH]c(nn1)SC(C)CNCC=C |
| InChi: | InChI=1S/C9H16N4S/c1-4-5-10-6-7(2)14-9-11-8(3)12-13-9/h4,7,10H,1,5-6H2,2-3H3,(H,11,12,13) |
| InChiKey: | InChIKey=RQHGJGOZPQJQGJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.