* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354663 |
English Synonyms: | UKRORGSYN-BB BBV-34354663 |
MDL Number.: | MFCD16805628 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1[nH]c(nn1)SCCNCCS(=O)(=O)C |
InChi: | InChI=1S/C8H16N4O2S2/c1-7-10-8(12-11-7)15-5-3-9-4-6-16(2,13)14/h9H,3-6H2,1-2H3,(H,10,11,12) |
InChiKey: | InChIKey=QTCXDOMGHBQNQY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.