* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34354668 |
| English Synonyms: | UKRORGSYN-BB BBV-34354668 |
| MDL Number.: | MFCD16805633 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1[nH]c(nn1)SC(C)CNCC(F)(F)F |
| InChi: | InChI=1S/C8H13F3N4S/c1-5(3-12-4-8(9,10)11)16-7-13-6(2)14-15-7/h5,12H,3-4H2,1-2H3,(H,13,14,15) |
| InChiKey: | InChIKey=CJZPTLAUWIGFIM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.