* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34354669 |
| English Synonyms: | UKRORGSYN-BB BBV-34354669 |
| MDL Number.: | MFCD16805634 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1[nH]c(nn1)SC(C)CNC |
| InChi: | InChI=1S/C7H14N4S/c1-5(4-8-3)12-7-9-6(2)10-11-7/h5,8H,4H2,1-3H3,(H,9,10,11) |
| InChiKey: | InChIKey=XLKBMSAXAGXQMB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.