* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354683 |
English Synonyms: | UKRORGSYN-BB BBV-34354683 |
MDL Number.: | MFCD16805648 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1[nH]c(nn1)SCCNCC(C)C |
InChi: | InChI=1S/C9H18N4S/c1-7(2)6-10-4-5-14-9-11-8(3)12-13-9/h7,10H,4-6H2,1-3H3,(H,11,12,13) |
InChiKey: | InChIKey=AYQPXXVKILPIFW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.