* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354707 |
English Synonyms: | UKRORGSYN-BB BBV-34354707 |
MDL Number.: | MFCD16805672 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(CNCCCOC)Sc1cnn(c1)C |
InChi: | InChI=1S/C11H21N3OS/c1-10(7-12-5-4-6-15-3)16-11-8-13-14(2)9-11/h8-10,12H,4-7H2,1-3H3 |
InChiKey: | InChIKey=CIKLIYHZGAVATF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.