* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34355305 |
English Synonyms: | UKRORGSYN-BB BBV-34355305 |
MDL Number.: | MFCD16806164 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNCCN(C)Cc1ccc(s1)CC |
InChi: | InChI=1S/C13H24N2S/c1-4-8-14-9-10-15(3)11-13-7-6-12(5-2)16-13/h6-7,14H,4-5,8-11H2,1-3H3 |
InChiKey: | InChIKey=TZBYGEAVSMKESG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.