* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34355786 |
English Synonyms: | UKRORGSYN-BB BBV-34355786 |
MDL Number.: | MFCD16806623 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCNCCN(C)c1c2ccsc2ncn1 |
InChi: | InChI=1S/C11H16N4S/c1-3-12-5-6-15(2)10-9-4-7-16-11(9)14-8-13-10/h4,7-8,12H,3,5-6H2,1-2H3 |
InChiKey: | InChIKey=RHGSVGMIBIQPFJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.