* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34355851 |
| English Synonyms: | UKRORGSYN-BB BBV-34355851 |
| MDL Number.: | MFCD16806688 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCn1ccnc1N(CCN)CC(C)C |
| InChi: | InChI=1S/C11H22N4/c1-4-14-8-6-13-11(14)15(7-5-12)9-10(2)3/h6,8,10H,4-5,7,9,12H2,1-3H3 |
| InChiKey: | InChIKey=BQAVYJGRSFUHAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.