* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-37839450 |
| English Synonyms: | UKRORGSYN-BB BBV-37839450 |
| MDL Number.: | MFCD16806760 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)N(CCN)c1c2c(nc[nH]2)ncn1 |
| InChi: | InChI=1S/C10H16N6/c1-7(2)16(4-3-11)10-8-9(13-5-12-8)14-6-15-10/h5-7H,3-4,11H2,1-2H3,(H,12,13,14,15) |
| InChiKey: | InChIKey=CVUAELBXKDXOKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.