* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-37839465 |
English Synonyms: | UKRORGSYN-BB BBV-37839465 |
MDL Number.: | MFCD16806774 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)N(CCN)c1c2ccsc2ncn1 |
InChi: | InChI=1S/C11H16N4S/c1-8(2)15(5-4-12)10-9-3-6-16-11(9)14-7-13-10/h3,6-8H,4-5,12H2,1-2H3 |
InChiKey: | InChIKey=BZRLERSWKRORCX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.