* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-37839467 |
| English Synonyms: | UKRORGSYN-BB BBV-37839467 |
| MDL Number.: | MFCD16806776 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)N(CCN)c1c2ccsc2ccn1 |
| InChi: | InChI=1S/C12H17N3S/c1-9(2)15(7-5-13)12-10-4-8-16-11(10)3-6-14-12/h3-4,6,8-9H,5,7,13H2,1-2H3 |
| InChiKey: | InChIKey=HROUBHZXSRNXII-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.