* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34356026 |
English Synonyms: | UKRORGSYN-BB BBV-34356026 |
MDL Number.: | MFCD16806858 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cn1ccnc1N(C)CCNC2CC2 |
InChi: | InChI=1S/C10H18N4/c1-13(7-5-11-9-3-4-9)10-12-6-8-14(10)2/h6,8-9,11H,3-5,7H2,1-2H3 |
InChiKey: | InChIKey=DAPWBBZTOYBTEH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.