* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34356409 |
English Synonyms: | UKRORGSYN-BB BBV-34356409 |
MDL Number.: | MFCD16807167 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(ccc1c2nnc3n2CCNC3)I |
InChi: | InChI=1S/C11H11IN4/c12-9-3-1-8(2-4-9)11-15-14-10-7-13-5-6-16(10)11/h1-4,13H,5-7H2 |
InChiKey: | InChIKey=QTYLJCAXEUAQGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.