* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34356429 |
English Synonyms: | UKRORGSYN-BB BBV-34356429 |
MDL Number.: | MFCD16807177 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C1CCC(C1)Cc2nnc3n2CCNC3 |
InChi: | InChI=1S/C11H18N4/c1-2-4-9(3-1)7-10-13-14-11-8-12-5-6-15(10)11/h9,12H,1-8H2 |
InChiKey: | InChIKey=CJCQAFSLYAIBPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.