* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34356455 |
English Synonyms: | UKRORGSYN-BB BBV-34356455 |
MDL Number.: | MFCD16807193 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1ccc(s1)c2nnc3n2CCNC3 |
InChi: | InChI=1S/C11H14N4S/c1-2-8-3-4-9(16-8)11-14-13-10-7-12-5-6-15(10)11/h3-4,12H,2,5-7H2,1H3 |
InChiKey: | InChIKey=POBQIHHGWJQNJI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.