* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34356463 |
English Synonyms: | UKRORGSYN-BB BBV-34356463 |
MDL Number.: | MFCD16807201 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1c2nnc(n2CCN1)CC(C)C |
InChi: | InChI=1S/C10H18N4/c1-7(2)6-9-12-13-10-8(3)11-4-5-14(9)10/h7-8,11H,4-6H2,1-3H3 |
InChiKey: | InChIKey=WUBONKTZIJYNMW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.