* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34356479 |
English Synonyms: | UKRORGSYN-BB BBV-34356479 |
MDL Number.: | MFCD16807217 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccsc1c2nnc3n2CCNC3C |
InChi: | InChI=1S/C11H14N4S/c1-7-3-6-16-9(7)11-14-13-10-8(2)12-4-5-15(10)11/h3,6,8,12H,4-5H2,1-2H3 |
InChiKey: | InChIKey=SMCGJYXKHDUPQN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.