* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34356499 |
| English Synonyms: | UKRORGSYN-BB BBV-34356499 |
| MDL Number.: | MFCD16807237 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC1c2nnc(n2CCN1)C3CCCCO3 |
| InChi: | InChI=1S/C11H18N4O/c1-8-10-13-14-11(15(10)6-5-12-8)9-4-2-3-7-16-9/h8-9,12H,2-7H2,1H3 |
| InChiKey: | InChIKey=NZCOSJJBWIYJIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.