* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-37738339 |
English Synonyms: | UKRORGSYN-BB BBV-37738339 |
MDL Number.: | MFCD16807359 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C1COCCC1CNC2CCS(=O)(=O)C2 |
InChi: | InChI=1S/C10H19NO3S/c12-15(13)6-3-10(8-15)11-7-9-1-4-14-5-2-9/h9-11H,1-8H2 |
InChiKey: | InChIKey=HYBXAVDFPBFXEZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.