* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-41804714 |
| English Synonyms: | UKRORGSYN-BB BBV-41804714 |
| MDL Number.: | MFCD16807959 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cn1cc(cn1)CNCCC(=O)NC2CC2 |
| InChi: | InChI=1S/C11H18N4O/c1-15-8-9(7-13-15)6-12-5-4-11(16)14-10-2-3-10/h7-8,10,12H,2-6H2,1H3,(H,14,16) |
| InChiKey: | InChIKey=YBPDNHYZSQFFIJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.