* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534190 |
English Synonyms: | UKRORGSYN-BB BBV-34534190 |
MDL Number.: | MFCD16808471 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCNC(c1ccco1)C2CCCCCC2 |
InChi: | InChI=1S/C14H23NO/c1-2-15-14(13-10-7-11-16-13)12-8-5-3-4-6-9-12/h7,10-12,14-15H,2-6,8-9H2,1H3 |
InChiKey: | InChIKey=AWUGZFVHBIZLEE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.