* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534198 |
English Synonyms: | UKRORGSYN-BB BBV-34534198 |
MDL Number.: | MFCD16808479 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCNC(C1CCCCCC1)C2=CCCC2 |
InChi: | InChI=1S/C15H27N/c1-2-16-15(14-11-7-8-12-14)13-9-5-3-4-6-10-13/h11,13,15-16H,2-10,12H2,1H3 |
InChiKey: | InChIKey=CKFBUTDMMYVFCD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.