* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34534265 |
| English Synonyms: | UKRORGSYN-BB BBV-34534265 |
| MDL Number.: | MFCD16808545 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CNC(Cc1cccs1)C2CCCCCC2 |
| InChi: | InChI=1S/C14H23NS/c1-15-14(11-13-9-6-10-16-13)12-7-4-2-3-5-8-12/h6,9-10,12,14-15H,2-5,7-8,11H2,1H3 |
| InChiKey: | InChIKey=IHUBGISELQFMLP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.