* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534342 |
English Synonyms: | UKRORGSYN-BB BBV-34534342 |
MDL Number.: | MFCD16808612 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cnc([nH]1)CC(C2CCCCCC2)O |
InChi: | InChI=1S/C12H20N2O/c15-11(9-12-13-7-8-14-12)10-5-3-1-2-4-6-10/h7-8,10-11,15H,1-6,9H2,(H,13,14) |
InChiKey: | InChIKey=NFOPJXJEAALNHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.