* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534345 |
English Synonyms: | UKRORGSYN-BB BBV-34534345 |
MDL Number.: | MFCD16808615 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C1CCCC(CC1)C(C2=CCCCC2)O |
InChi: | InChI=1S/C14H24O/c15-14(13-10-6-3-7-11-13)12-8-4-1-2-5-9-12/h10,12,14-15H,1-9,11H2 |
InChiKey: | InChIKey=AEVNHEGTLMCHRL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.