* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534474 |
English Synonyms: | UKRORGSYN-BB BBV-34534474 |
MDL Number.: | MFCD16808736 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COCCC(=O)Nc1cnn(c1)CC(=O)O |
InChi: | InChI=1S/C9H13N3O4/c1-16-3-2-8(13)11-7-4-10-12(5-7)6-9(14)15/h4-5H,2-3,6H2,1H3,(H,11,13)(H,14,15) |
InChiKey: | InChIKey=KPQLTFASOOKOFL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.