* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534482 |
English Synonyms: | UKRORGSYN-BB BBV-34534482 |
MDL Number.: | MFCD16808743 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | COCCC(=O)N[C@@H](CCC(=O)O)C(=O)O |
InChi: | InChI=1S/C9H15NO6/c1-16-5-4-7(11)10-6(9(14)15)2-3-8(12)13/h6H,2-5H2,1H3,(H,10,11)(H,12,13)(H,14,15)/t6-/m0/s1 |
InChiKey: | InChIKey=AEFDKLIJSVJKCN-LURJTMIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.