* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534831 |
English Synonyms: | UKRORGSYN-BB BBV-34534831 |
MDL Number.: | MFCD16809080 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COCCc1nc(no1)CCN |
InChi: | InChI=1S/C7H13N3O2/c1-11-5-3-7-9-6(2-4-8)10-12-7/h2-5,8H2,1H3 |
InChiKey: | InChIKey=VZEIVLKQJBKYIJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.