* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34535063 |
English Synonyms: | UKRORGSYN-BB BBV-34535063 |
MDL Number.: | MFCD16809293 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCOCCc1nnc(n1N)SCC(=O)O |
InChi: | InChI=1S/C8H14N4O3S/c1-2-15-4-3-6-10-11-8(12(6)9)16-5-7(13)14/h2-5,9H2,1H3,(H,13,14) |
InChiKey: | InChIKey=YSESCBRSFCOCRG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.