* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34535617 |
| English Synonyms: | UKRORGSYN-BB BBV-34535617 |
| MDL Number.: | MFCD16809823 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1Sc2cc(nn2C)C)N |
| InChi: | InChI=1S/C12H15N3S/c1-8-4-5-10(13)7-11(8)16-12-6-9(2)14-15(12)3/h4-7H,13H2,1-3H3 |
| InChiKey: | InChIKey=MKFXXJAWNOKIPP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.