* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34535621 |
English Synonyms: | UKRORGSYN-BB BBV-34535621 |
MDL Number.: | MFCD16809825 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc2c(cc1N)nc(n2C3CC3)CO |
InChi: | InChI=1S/C11H13N3O/c12-7-1-4-10-9(5-7)13-11(6-15)14(10)8-2-3-8/h1,4-5,8,15H,2-3,6,12H2 |
InChiKey: | InChIKey=YQVMIXKCVCPZGD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.