* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34535629 |
English Synonyms: | UKRORGSYN-BB BBV-34535629 |
MDL Number.: | MFCD16809831 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc2c(cc1N)nc(n2CC3CC3)CO |
InChi: | InChI=1S/C12H15N3O/c13-9-3-4-11-10(5-9)14-12(7-16)15(11)6-8-1-2-8/h3-5,8,16H,1-2,6-7,13H2 |
InChiKey: | InChIKey=JVHKCPYVVYDLPN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.