* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34535630 |
| English Synonyms: | UKRORGSYN-BB BBV-34535630 |
| MDL Number.: | MFCD16809832 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(C)n1c2ccc(cc2nc1CO)N |
| InChi: | InChI=1S/C11H15N3O/c1-7(2)14-10-4-3-8(12)5-9(10)13-11(14)6-15/h3-5,7,15H,6,12H2,1-2H3 |
| InChiKey: | InChIKey=QXHGSDBKJKYQBO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.