* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34535631 |
English Synonyms: | UKRORGSYN-BB BBV-34535631 |
MDL Number.: | MFCD16809833 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(C)n1c2ccc(cc2nc1C(C)O)N |
InChi: | InChI=1S/C12H17N3O/c1-7(2)15-11-5-4-9(13)6-10(11)14-12(15)8(3)16/h4-8,16H,13H2,1-3H3 |
InChiKey: | InChIKey=MMGNJIGWMUGSCJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.