* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-40144372 |
| English Synonyms: | UKRORGSYN-BB BBV-40144372 |
| MDL Number.: | MFCD00136764 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CC(C)[C@H](C(=O)O)NC(=O)[C@@H](C)N |
| InChi: | InChI=1S/C8H16N2O3/c1-4(2)6(8(12)13)10-7(11)5(3)9/h4-6H,9H2,1-3H3,(H,10,11)(H,12,13)/t5-,6-/m1/s1 |
| InChiKey: | InChIKey=LIWMQSWFLXEGMA-PHDIDXHHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.